ChemNet > CAS > 6276-04-6 1-iodo-3,5-dinitrobenzene
6276-04-6 1-iodo-3,5-dinitrobenzene
| 상품명칭 |
1-iodo-3,5-dinitrobenzene |
| 영문 이름 |
1-iodo-3,5-dinitrobenzene; |
| 분자식 |
C6H3IN2O4 |
| 분자량 |
294.0035 |
| InChI |
InChI=1/C6H3IN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H |
| cas번호 |
6276-04-6 |
| 분자 구조 |
|
| 밀도 |
2.174g/cm3 |
| 녹는 점 |
108-111℃ |
| 비등점 |
346°C at 760 mmHg |
| 굴절 지수 |
1.699 |
| 인화점 |
163.1°C |
| 증기압 |
0.000118mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R42/43:May cause sensitization by inhalation and skin contact.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
|
|
