ChemNet > CAS > 6282-00-4 NN-Dipropylformamide
6282-00-4 NN-Dipropylformamide
| 상품명칭 |
NN-Dipropylformamide |
| 영문 이름 |
NN-Dipropylformamide; N,N-Di-n-propylformamide; N,N-dipropylformamide |
| 분자식 |
C7H15NO |
| 분자량 |
129.2001 |
| InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| cas번호 |
6282-00-4 |
| 분자 구조 |
|
| 밀도 |
0.869g/cm3 |
| 비등점 |
221.3°C at 760 mmHg |
| 굴절 지수 |
1.429 |
| 인화점 |
83.7°C |
| 증기압 |
0.108mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
