ChemNet > CAS > 6304-16-1 (4-Pyridyl)acetone
6304-16-1 (4-Pyridyl)acetone
상품명칭 |
(4-Pyridyl)acetone |
영문 이름 |
(4-Pyridyl)acetone; 1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
분자식 |
C8H9NO |
분자량 |
135.1632 |
InChI |
InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
cas번호 |
6304-16-1 |
EC번호 |
228-605-7 |
분자 구조 |
|
밀도 |
1.047g/cm3 |
비등점 |
232.523°C at 760 mmHg |
굴절 지수 |
1.509 |
인화점 |
100.06°C |
증기압 |
0.059mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|