ChemNet > CAS > 6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
상품명칭 |
3,4-(Methylenedioxy)-6-nitrocinnamic acid |
영문 이름 |
3,4-(Methylenedioxy)-6-nitrocinnamic acid; (2Z)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
분자식 |
C10H6NO6 |
분자량 |
236.1583 |
InChI |
InChI=1/C10H7NO6/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15/h1-4H,5H2,(H,12,13)/p-1/b2-1+ |
cas번호 |
6315-90-8 |
분자 구조 |
|
비등점 |
452.3°C at 760 mmHg |
인화점 |
227.3°C |
증기압 |
5.73E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36:Wear suitable protective clothing.;
|
|