ChemNet > CAS > 6320-15-6 6-Chloro-2,4-dimethixypyrimidine
6320-15-6 6-Chloro-2,4-dimethixypyrimidine
| 상품명칭 |
6-Chloro-2,4-dimethixypyrimidine |
| 영문 이름 |
6-Chloro-2,4-dimethixypyrimidine; 6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
| 분자식 |
C6H7ClN2O2 |
| 분자량 |
174.585 |
| InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
| cas번호 |
6320-15-6 |
| EC번호 |
228-669-6 |
| 분자 구조 |
|
| 밀도 |
1.285g/cm3 |
| 녹는 점 |
74-76℃ |
| 비등점 |
280.6°C at 760 mmHg |
| 굴절 지수 |
1.51 |
| 인화점 |
123.5°C |
| 증기압 |
0.00637mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
