ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
상품명칭 |
4,5-Dibromothiophene-2-carboxylic acid |
영문 이름 |
4,5-Dibromothiophene-2-carboxylic acid;4,5-Dibromothenoic acid |
분자식 |
C5H2Br2O2S |
분자량 |
285.9412 |
InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
cas번호 |
6324-10-3 |
EC번호 |
228-683-2 |
분자 구조 |
|
밀도 |
2.309g/cm3 |
비등점 |
367.1°C at 760 mmHg |
굴절 지수 |
1.682 |
인화점 |
175.8°C |
증기압 |
4.91E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|