ChemNet > CAS > 6324-11-4 (2-hydroxyphenoxy)acetic acid
6324-11-4 (2-hydroxyphenoxy)acetic acid
상품명칭 |
(2-hydroxyphenoxy)acetic acid |
영문 이름 |
(2-hydroxyphenoxy)acetic acid; 2-Hydroxyphenoxyacetic acid |
분자식 |
C8H8O4 |
분자량 |
168.1467 |
InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
cas번호 |
6324-11-4 |
EC번호 |
228-684-8 |
분자 구조 |
|
밀도 |
1.367g/cm3 |
녹는 점 |
138-141℃ |
비등점 |
339.6°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
143°C |
증기압 |
3.52E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|