6326-14-3 2,4-Dichlorophenylthiourae

상품명칭	2,4-Dichlorophenylthiourae
영문 이름	2,4-Dichlorophenylthiourae;
분자식	C₇H₆Cl₂N₂S
분자량	221.1069
InChI	InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12)
cas번호	6326-14-3
분자 구조
밀도	1.563g/cm³
비등점	321.8°C at 760 mmHg
굴절 지수	1.73
인화점	148.4°C
증기압	0.000292mmHg at 25°C
위험성 표시
리스크 규칙	R20/22:Harmful by inhalation and if swallowed.;
보안 규칙	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.;