ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
상품명칭 |
Bis(carboxymethyl) trithiocarbonate |
영문 이름 |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
분자식 |
C5H4O4S3 |
분자량 |
224.279 |
InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
cas번호 |
6326-83-6 |
EC번호 |
228-693-7 |
분자 구조 |
|
녹는 점 |
170-175℃ |
비등점 |
532.5°C at 760 mmHg |
인화점 |
275.9°C |
증기압 |
9.26E-13mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|