ChemNet > CAS > 6336-58-9 3-Dibutylamino-1-propyne
6336-58-9 3-Dibutylamino-1-propyne
상품명칭 |
3-Dibutylamino-1-propyne |
영문 이름 |
3-Dibutylamino-1-propyne;N-butyl-N-(prop-2-yn-1-yl)butan-1-amine |
분자식 |
C11H21N |
분자량 |
167.2911 |
InChI |
InChI=1/C11H21N/c1-4-7-10-12(9-6-3)11-8-5-2/h3H,4-5,7-11H2,1-2H3 |
cas번호 |
6336-58-9 |
분자 구조 |
|
밀도 |
0.831g/cm3 |
비등점 |
224.4°C at 760 mmHg |
굴절 지수 |
1.454 |
인화점 |
81.4°C |
증기압 |
0.0913mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|