ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
| 상품명칭 |
5-nitro-1-benzothiophene-2-carboxylic acid |
| 영문 이름 |
5-nitro-1-benzothiophene-2-carboxylic acid;5-nitro-1-benzothiophene-2-carboxylate |
| 분자식 |
C9H4NO4S |
| 분자량 |
222.1979 |
| InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
| cas번호 |
6345-55-7 |
| 분자 구조 |
|
| 녹는 점 |
238℃ |
| 비등점 |
473.6°C at 760 mmHg |
| 인화점 |
240.2°C |
| 증기압 |
8.93E-10mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
