ChemNet > CAS > 635-10-9 Tetramethyl 1,2,4,5-Benzenetetracarboxylate
635-10-9 Tetramethyl 1,2,4,5-Benzenetetracarboxylate
| 상품명칭 |
Tetramethyl 1,2,4,5-Benzenetetracarboxylate |
| 영문 이름 |
Tetramethyl 1,2,4,5-Benzenetetracarboxylate; Tetramethyl pyromellitate; Pyromellitic acid tetramethyl ester~Tetramethyl benzene-1,2,4,5-tetracarboxylate; tetramethyl benzene-1,2,4,5-tetracarboxylate |
| 분자식 |
C14H14O8 |
| 분자량 |
310.2562 |
| InChI |
InChI=1/C14H14O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h5-6H,1-4H3 |
| cas번호 |
635-10-9 |
| EC번호 |
211-226-6 |
| 분자 구조 |
|
| 밀도 |
1.287g/cm3 |
| 비등점 |
370.9°C at 760 mmHg |
| 굴절 지수 |
1.52 |
| 인화점 |
161.5°C |
| 증기압 |
1.07E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
