635-90-5 1-Phenylpyrrole
상품명칭 |
1-Phenylpyrrole |
영문 이름 |
1-Phenylpyrrole; (1-Pyrrolyl)benzene; 1-phenyl-1H-pyrrole |
분자식 |
C10H9N |
분자량 |
143.1852 |
InChI |
InChI=1/C10H9N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9H |
cas번호 |
635-90-5 |
EC번호 |
211-242-3 |
분자 구조 |
|
밀도 |
0.97g/cm3 |
녹는 점 |
58-60℃ |
비등점 |
234°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
95.3°C |
증기압 |
0.0827mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|