ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
| 상품명칭 |
Triethylamine hydrobromide |
| 영문 이름 |
Triethylamine hydrobromide; triethylammonium bromide |
| 분자식 |
C6H15N.HBr |
| 분자량 |
182.10 |
| InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| cas번호 |
636-70-4 |
| EC번호 |
211-263-8 |
| 분자 구조 |
|
| 녹는 점 |
246-248℃ |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
