ChemNet > CAS > 636-93-1 2-methoxy-5-nitrophenol
636-93-1 2-methoxy-5-nitrophenol
| 상품명칭 |
2-methoxy-5-nitrophenol |
| 영문 이름 |
2-methoxy-5-nitrophenol; 5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene); 3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol; 5-Nitroguaiacol |
| 분자식 |
C7H7NO4 |
| 분자량 |
169.1348 |
| InChI |
InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
| cas번호 |
636-93-1 |
| EC번호 |
211-269-0 |
| 분자 구조 |
|
| 밀도 |
1.367g/cm3 |
| 녹는 점 |
103-107℃ |
| 비등점 |
291°C at 760 mmHg |
| 굴절 지수 |
1.583 |
| 인화점 |
147.1°C |
| 증기압 |
0.00115mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
