ChemNet > CAS > 63762-78-7 2-Fluoro-5-methylanisole
63762-78-7 2-Fluoro-5-methylanisole
상품명칭 |
2-Fluoro-5-methylanisole |
영문 이름 |
2-Fluoro-5-methylanisole; Fluoromethylanisole1; 4-Fluoro-3-methoxytoluene; 1-fluoro-2-methoxy-4-methylbenzene |
분자식 |
C8H9FO |
분자량 |
140.1549 |
InChI |
InChI=1/C8H9FO/c1-6-3-4-7(9)8(5-6)10-2/h3-5H,1-2H3 |
cas번호 |
63762-78-7 |
분자 구조 |
|
밀도 |
1.046g/cm3 |
비등점 |
182.5°C at 760 mmHg |
굴절 지수 |
1.475 |
인화점 |
63.7°C |
증기압 |
1.1mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|