ChemNet > CAS > 64038-64-8 ethyl 2-mercapto-1H-imidazole-4-carboxylate
64038-64-8 ethyl 2-mercapto-1H-imidazole-4-carboxylate
상품명칭 |
ethyl 2-mercapto-1H-imidazole-4-carboxylate |
영문 이름 |
ethyl 2-mercapto-1H-imidazole-4-carboxylate; ethyl 2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylate |
분자식 |
C6H8N2O2S |
분자량 |
172.2049 |
InChI |
InChI=1/C6H8N2O2S/c1-2-10-5(9)4-3-7-6(11)8-4/h3H,2H2,1H3,(H2,7,8,11) |
cas번호 |
64038-64-8 |
분자 구조 |
|
밀도 |
1.35g/cm3 |
녹는 점 |
191℃ |
비등점 |
254.3°C at 760 mmHg |
굴절 지수 |
1.605 |
인화점 |
107.6°C |
증기압 |
0.0174mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|