ChemNet > CAS > 64123-77-9 Methyl 3-fluorophenylacetate
64123-77-9 Methyl 3-fluorophenylacetate
상품명칭 |
Methyl 3-fluorophenylacetate |
영문 이름 |
Methyl 3-fluorophenylacetate; |
분자식 |
C9H9FO2 |
분자량 |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3 |
cas번호 |
64123-77-9 |
분자 구조 |
|
밀도 |
1.148g/cm3 |
비등점 |
204°C at 760 mmHg |
굴절 지수 |
1.488 |
인화점 |
75.3°C |
증기압 |
0.27mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|