ChemNet > CAS > 64218-50-4 2-클로로-1-(4,5-디클로로-2-티에닐)에탄-1-온
64218-50-4 2-클로로-1-(4,5-디클로로-2-티에닐)에탄-1-온
상품명칭 |
2-클로로-1-(4,5-디클로로-2-티에닐)에탄-1-온 |
별명 |
2-클로로-1-(4,5-디클로로티오펜-2-일)에타논 |
영문 이름 |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one;2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
분자식 |
C6H3Cl3OS |
분자량 |
229.5114 |
InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
cas번호 |
64218-50-4 |
분자 구조 |
|
밀도 |
1.574g/cm3 |
녹는 점 |
56℃ |
비등점 |
355.8°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
169°C |
증기압 |
3.05E-05mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|