ChemNet > CAS > 64287-19-0 4-Fluoro-3-methoxyacetophenone
64287-19-0 4-Fluoro-3-methoxyacetophenone
상품명칭 |
4-Fluoro-3-methoxyacetophenone |
영문 이름 |
4-Fluoro-3-methoxyacetophenone; 1-(4-Fluoro-3-methoxyphenyl)ethanone; Ethanone, 2-amino-1-(2,4-difluorophenyl)-; 4'-Fluoro-3'-methoxyacetophenone |
분자식 |
C8H7F2NO |
분자량 |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3H,4,11H2 |
cas번호 |
64287-19-0 |
분자 구조 |
|
밀도 |
1.286g/cm3 |
비등점 |
255.9°C at 760 mmHg |
굴절 지수 |
1.51 |
인화점 |
108.6°C |
증기압 |
0.0159mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|