ChemNet > CAS > 64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
| 상품명칭 |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
| 영문 이름 |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile; 1-(p-Chlorophenyl)cyclopropanecarbonitrile; 1-(4-chlorophenyl)cyclopropanecarbonitrile |
| 분자식 |
C10H8ClN |
| 분자량 |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
| cas번호 |
64399-27-5 |
| EC번호 |
264-871-0 |
| 분자 구조 |
|
| 밀도 |
1.24g/cm3 |
| 녹는 점 |
52-56℃ |
| 비등점 |
303.1°C at 760 mmHg |
| 굴절 지수 |
1.589 |
| 인화점 |
133.1°C |
| 증기압 |
0.000947mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
