ChemNet > CAS > 646-01-5 3-(Methylthio)propionic acid
646-01-5 3-(Methylthio)propionic acid
상품명칭 |
3-(Methylthio)propionic acid |
영문 이름 |
3-(Methylthio)propionic acid; 3-Methythiopropionic acid; 3-(methylsulfanyl)propanoate; 3-Methylthiopropionic Acid |
분자식 |
C4H7O2S |
분자량 |
119.1627 |
InChI |
InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
cas번호 |
646-01-5 |
EC번호 |
211-460-9 |
분자 구조 |
|
비등점 |
249.2°C at 760 mmHg |
인화점 |
104.5°C |
증기압 |
0.00741mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|