6483-50-7 1,4-Diethylpiperazine
상품명칭 |
1,4-Diethylpiperazine |
영문 이름 |
1,4-Diethylpiperazine;Piperazine, 1,4-diethyl-; 1,4-diethylpiperazinediium |
분자식 |
C8H20N2 |
분자량 |
144.2567 |
InChI |
InChI=1/C8H18N2/c1-3-9-5-7-10(4-2)8-6-9/h3-8H2,1-2H3/p+2 |
cas번호 |
6483-50-7 |
EC번호 |
229-341-5 |
분자 구조 |
|
비등점 |
185°C at 760 mmHg |
인화점 |
58.1°C |
증기압 |
0.714mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|