ChemNet > CAS > 652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
| 상품명칭 |
2',3',4',5',6'-Pentafluoroacetophenone |
| 영문 이름 |
2',3',4',5',6'-Pentafluoroacetophenone; 2,3,4,5,6-Pentafluoroacetophenone; 1-(pentafluorophenyl)ethanone |
| 분자식 |
C8H3F5O |
| 분자량 |
210.1008 |
| InChI |
InChI=1/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| cas번호 |
652-29-9 |
| EC번호 |
211-487-6 |
| 분자 구조 |
|
| 밀도 |
1.479g/cm3 |
| 비등점 |
130.5°C at 760 mmHg |
| 굴절 지수 |
1.424 |
| 인화점 |
65.6°C |
| 증기압 |
9.68mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
