ChemNet > CAS > 652-40-4 3,6-difluorophthalic anhydride
652-40-4 3,6-difluorophthalic anhydride
상품명칭 |
3,6-difluorophthalic anhydride |
영문 이름 |
3,6-difluorophthalic anhydride;1,1'-(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)bis(3,4-dimethylbenzene); 4,7-difluoro-2-benzofuran-1,3-dione |
분자식 |
C8H2F2O3 |
분자량 |
184.0965 |
InChI |
InChI=1/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H |
cas번호 |
652-40-4 |
EC번호 |
265-687-3 |
분자 구조 |
|
밀도 |
1.658g/cm3 |
녹는 점 |
218-221℃ |
비등점 |
315.7°C at 760 mmHg |
굴절 지수 |
1.555 |
인화점 |
140.1°C |
증기압 |
0.000429mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|