ChemNet > CAS > 656-31-5 2-fluorophenylurea
656-31-5 2-fluorophenylurea
상품명칭 |
2-fluorophenylurea |
영문 이름 |
2-fluorophenylurea;(2-Fluorophenyl)urea; (o-Fluorophenyl)urea; Urea, (o-fluorophenyl)-; 1-(2-fluorophenyl)urea |
분자식 |
C7H7FN2O |
분자량 |
154.1417 |
InChI |
InChI=1/C7H7FN2O/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
cas번호 |
656-31-5 |
EC번호 |
211-513-6 |
분자 구조 |
|
밀도 |
1.353g/cm3 |
비등점 |
228.1°C at 760 mmHg |
굴절 지수 |
1.608 |
인화점 |
91.7°C |
증기압 |
0.0748mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|