656-32-6 1-(2-fluorophenyl)-2-thiourea

상품명칭	1-(2-fluorophenyl)-2-thiourea
영문 이름	1-(2-fluorophenyl)-2-thiourea; 2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea
분자식	C₇H₇FN₂S
분자량	170.2073
InChI	InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11)
cas번호	656-32-6
분자 구조
밀도	1.397g/cm³
녹는 점	143-145℃
비등점	257°C at 760 mmHg
굴절 지수	1.692
인화점	109.2°C
증기압	0.0149mmHg at 25°C
위험성 표시
리스크 규칙	R25:Toxic if swallowed.;
보안 규칙	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;