ChemNet > CAS > 656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
| 상품명칭 |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde |
| 영문 이름 |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde; 2,2-Difluoro-5-formyl-1,3-benzodioxole; 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde; 2,2-Difluorobenzodioxole-5-Carboxaldehyde; 2,2-Difluoro-5-formylbenzodioxole;
|
| 분자식 |
C8H4F2O3 |
| 분자량 |
186.1124 |
| InChI |
InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H |
| cas번호 |
656-42-8 |
| 분자 구조 |
|
| 밀도 |
1.5g/cm3 |
| 비등점 |
210.5°C at 760 mmHg |
| 굴절 지수 |
1.525 |
| 인화점 |
79.1°C |
| 증기압 |
0.191mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
