6587-24-2 methyl 2-cyanobenzoate
상품명칭 |
methyl 2-cyanobenzoate |
영문 이름 |
methyl 2-cyanobenzoate; |
분자식 |
C9H7NO2 |
분자량 |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
cas번호 |
6587-24-2 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
녹는 점 |
47℃ |
비등점 |
295.8°C at 760 mmHg |
굴절 지수 |
1.535 |
인화점 |
136.2°C |
증기압 |
0.00149mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|