ChemNet > CAS > 6603-71-0 4-methylcyclohexaneacetic acid, mixture of C
6603-71-0 4-methylcyclohexaneacetic acid, mixture of C
상품명칭 |
4-methylcyclohexaneacetic acid, mixture of C |
영문 이름 |
4-methylcyclohexaneacetic acid, mixture of C; 4-Methylcyclohexaneacetic acid,mixture of cis and trans; (4-methylcyclohexyl)acetic acid; 4-METHYLCYCLOHEXANEACETIC ACID |
분자식 |
C9H16O2 |
분자량 |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-7-2-4-8(5-3-7)6-9(10)11/h7-8H,2-6H2,1H3,(H,10,11) |
cas번호 |
6603-71-0 |
분자 구조 |
|
밀도 |
0.984g/cm3 |
비등점 |
253.7°C at 760 mmHg |
굴절 지수 |
1.457 |
인화점 |
121.7°C |
증기압 |
0.00558mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|