ChemNet > CAS > 66147-75-9 7-Benzoylheptanoic acid
66147-75-9 7-Benzoylheptanoic acid
| 상품명칭 |
7-Benzoylheptanoic acid |
| 영문 이름 |
7-Benzoylheptanoic acid; 8-Oxo-8-phenyloctanoic acid |
| 분자식 |
C14H18O3 |
| 분자량 |
234.2909 |
| InChI |
InChI=1/C14H18O3/c15-13(12-8-4-3-5-9-12)10-6-1-2-7-11-14(16)17/h3-5,8-9H,1-2,6-7,10-11H2,(H,16,17) |
| cas번호 |
66147-75-9 |
| 분자 구조 |
|
| 밀도 |
1.091g/cm3 |
| 비등점 |
407.1°C at 760 mmHg |
| 굴절 지수 |
1.523 |
| 인화점 |
214.2°C |
| 증기압 |
2.33E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
