ChemNet > CAS > 6639-79-8 2,3-Dihydroxy-6-chloroquinoxaline
6639-79-8 2,3-Dihydroxy-6-chloroquinoxaline
상품명칭 |
2,3-Dihydroxy-6-chloroquinoxaline |
영문 이름 |
2,3-Dihydroxy-6-chloroquinoxaline; |
분자식 |
C8H5ClN2O2 |
분자량 |
196.59 |
InChI |
InChI=1/C8H5ClN2O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13) |
cas번호 |
6639-79-8 |
EC번호 |
229-647-9 |
분자 구조 |
|
녹는 점 |
250℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|