ChemNet > CAS > 6640-09-1 5-Benzyloxyindole-2-carboxylic acid
6640-09-1 5-Benzyloxyindole-2-carboxylic acid
상품명칭 |
5-Benzyloxyindole-2-carboxylic acid |
영문 이름 |
5-Benzyloxyindole-2-carboxylic acid; 5-(Benzyloxy)-1H-indole-2-carboxylic acid |
분자식 |
C16H13NO3 |
분자량 |
267.2793 |
InChI |
InChI=1/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
cas번호 |
6640-09-1 |
EC번호 |
229-652-6 |
분자 구조 |
|
밀도 |
1.342g/cm3 |
녹는 점 |
192℃ |
비등점 |
531.1°C at 760 mmHg |
굴절 지수 |
1.696 |
인화점 |
275°C |
증기압 |
4.13E-12mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|