ChemNet > CAS > 6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
| 상품명칭 |
4,5-Diphenyl-4-oxazoline-2-thione |
| 영문 이름 |
4,5-Diphenyl-4-oxazoline-2-thione; 4,5-Diphenyl-2-oxazolethiol; 4,5-Diphenyl-2-mercaptooxazole; 4,5-diphenyl-1,3-oxazole-2(3H)-thione |
| 분자식 |
C15H11NOS |
| 분자량 |
253.3189 |
| InChI |
InChI=1/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| cas번호 |
6670-13-9 |
| EC번호 |
229-707-4 |
| 분자 구조 |
|
| 밀도 |
1.31g/cm3 |
| 녹는 점 |
256-260℃ |
| 비등점 |
390.6°C at 760 mmHg |
| 굴절 지수 |
1.708 |
| 인화점 |
190.1°C |
| 증기압 |
2.61E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
