ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
상품명칭 |
2-Amino-5-methoxybenzoic acid |
영문 이름 |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
분자식 |
C8H8N2O |
분자량 |
148.1619 |
InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
cas번호 |
6705-03-9 |
분자 구조 |
|
밀도 |
1.17g/cm3 |
녹는 점 |
148-152℃ |
비등점 |
302.2°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
136.6°C |
증기압 |
0.00101mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|