ChemNet > CAS > 67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
상품명칭 |
2-Chloro-N-methoxy-N-methylacetamide |
영문 이름 |
2-Chloro-N-methoxy-N-methylacetamide; Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
분자식 |
C4H8ClNO2 |
분자량 |
137.5648 |
InChI |
InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
cas번호 |
67442-07-3 |
분자 구조 |
|
밀도 |
1.178g/cm3 |
녹는 점 |
39-41℃ |
비등점 |
141.5°C at 760 mmHg |
굴절 지수 |
1.442 |
인화점 |
39.4°C |
증기압 |
5.83mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|