ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
상품명칭 |
3,5-Dibromo-4-methylbenzoic acid |
영문 이름 |
3,5-Dibromo-4-methylbenzoic acid; 3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
분자식 |
C8H6Br2O2 |
분자량 |
293.94 |
InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
cas번호 |
67973-32-4 |
분자 구조 |
|
밀도 |
1.951g/cm3 |
비등점 |
374.6°C at 760 mmHg |
굴절 지수 |
1.627 |
인화점 |
180.3°C |
증기압 |
2.82E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|