| 상품명칭 |
l-글루탐산, N-코코 아실 유도체, 트리에탄올아민 compds.with (1:1) |
| 별명 |
L-글루탐산, N-코코 아실 유도체, compds.트리에탄올아민으로; TEA-코코일 글루타메이트; 트리에탄올아민 코코일 글루타메이트; N-코코일-L-글루탐산, 모노(트리에탄올아민) 염; L-글루탐산, N-코코 아실 유도체, compds.트리에탄올아민 (1 : 1); l-글루탐산, N-코코 아실 유도체, 트리에탄올아민(1:1) 함유 |
| 영문 이름 |
l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine; TEA-Cocoyl glutamate; Triethanolamine cocoyl glutamate; N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt; L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine(1:1); l-Glutamic acid,N-coco acyl derivs.,compds. with triethanolamine(1:1);
|
| 분자식 |
C6H15NO3・C5H9NO4 |
| 분자량 |
296.318 |
| InChI |
InChI=1/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| cas번호 |
68187-29-1 |
| EC번호 |
269-084-6 |
| 분자 구조 |
|
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
