ChemNet > CAS > 68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
상품명칭 |
3-Amino-3-(3-methoxyphenyl)propionic acid |
영문 이름 |
3-Amino-3-(3-methoxyphenyl)propionic acid; (3S)-3-amino-3-(3-methoxyphenyl)propanoic acid; (3R)-3-amino-3-(3-methoxyphenyl)propanoic acid; 3-amino-3-(3-methoxyphenyl)propanoic acid |
분자식 |
C10H13NO3 |
분자량 |
195.2151 |
InChI |
InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
cas번호 |
68208-19-5 |
분자 구조 |
|
밀도 |
1.206g/cm3 |
비등점 |
350.2°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
165.6°C |
증기압 |
1.66E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|