ChemNet > CAS > 6863-58-7 sec-Butyl ether (stabilized with HQ)
6863-58-7 sec-Butyl ether (stabilized with HQ)
상품명칭 |
sec-Butyl ether (stabilized with HQ) |
영문 이름 |
sec-Butyl ether (stabilized with HQ);Butane, 2,2'-oxybis-; 0-01-00-00372 (Beilstein Handbook Reference); 2,2'-Oxybisbutane; BRN 1733014; Bis(2-butyl)ether; Di-sec-butyl ether; sec-Butyl ether |
분자식 |
C8H18O |
분자량 |
130.2279 |
InChI |
InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3 |
cas번호 |
6863-58-7 |
EC번호 |
229-961-6 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|