69038-81-9 2-Ethoxycinnamic acid
상품명칭 |
2-Ethoxycinnamic acid |
영문 이름 |
2-Ethoxycinnamic acid;(2E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
분자식 |
C11H12O3 |
분자량 |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b8-7+ |
cas번호 |
69038-81-9 |
분자 구조 |
|
밀도 |
1.161g/cm3 |
녹는 점 |
134-138℃ |
비등점 |
337.2°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
131.7°C |
증기압 |
4.18E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|