ChemNet > CAS > 69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
상품명칭 |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle |
영문 이름 |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle; 1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; 3,3-dimethyl-1,5-dioxaspiro(5.5)undecan-9-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one; 1,4-Cyclohexanedione Mono(2,2-Dimethyltrimethylene Ketal) |
분자식 |
C11H18O3 |
분자량 |
198.2588 |
InChI |
InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
cas번호 |
69225-59-8 |
EC번호 |
273-918-4 |
분자 구조 |
|
밀도 |
1.08g/cm3 |
녹는 점 |
45-50℃ |
비등점 |
295.4°C at 760 mmHg |
굴절 지수 |
1.484 |
인화점 |
123.3°C |
증기압 |
0.00153mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|