69321-60-4 2,6-Dibromotoluene
상품명칭 |
2,6-Dibromotoluene |
영문 이름 |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
분자식 |
C7H6Br2 |
분자량 |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
cas번호 |
69321-60-4 |
분자 구조 |
|
밀도 |
1.81g/cm3 |
비등점 |
246°C at 760 mmHg |
굴절 지수 |
1.587 |
인화점 |
106.6°C |
증기압 |
0.0436mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|