6937-34-4 3-iodophthalic acid
상품명칭 |
3-iodophthalic acid |
영문 이름 |
3-iodophthalic acid; 3-iodobenzene-1,2-dicarboxylic acid; 3-Iodophthaltc acid |
분자식 |
C8H5IO4 |
분자량 |
292.0274 |
InChI |
InChI=1/C8H5IO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
cas번호 |
6937-34-4 |
분자 구조 |
|
밀도 |
2.138g/cm3 |
녹는 점 |
232℃ |
비등점 |
426.3°C at 760 mmHg |
굴절 지수 |
1.704 |
인화점 |
211.6°C |
증기압 |
5.01E-08mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|