ChemNet > CAS > 6950-92-1 2,4,6-Trimethylphenethylalcohol
6950-92-1 2,4,6-Trimethylphenethylalcohol
상품명칭 |
2,4,6-Trimethylphenethylalcohol |
영문 이름 |
2,4,6-Trimethylphenethylalcohol; 2-Mesitylethanol; 2-Hydroxyethylmesitylene~2,4,6-Trimethylphenethyl alcohol~2-(2,4,6-Trimethylphenyl)ethanol; 2-(2,4,6-trimethylphenyl)ethanol |
분자식 |
C11H16O |
분자량 |
164.2441 |
InChI |
InChI=1/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3 |
cas번호 |
6950-92-1 |
EC번호 |
230-123-7 |
분자 구조 |
|
밀도 |
0.974g/cm3 |
비등점 |
290.7°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
138.4°C |
증기압 |
0.000939mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|