6968-28-1 4-bromophthalic acid
상품명칭 |
4-bromophthalic acid |
영문 이름 |
4-bromophthalic acid; 4-Bromo-1,2-benzenedicarboxylic Acid; 4-bromobenzene-1,2-dicarboxylic acid; 4-bromobenzene-1,2-dicarboxylate |
분자식 |
C8H3BrO4 |
분자량 |
243.0121 |
InChI |
InChI=1/C8H5BrO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
cas번호 |
6968-28-1 |
EC번호 |
230-183-4 |
분자 구조 |
|
비등점 |
412.4°C at 760 mmHg |
인화점 |
203.2°C |
증기압 |
1.54E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|