ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
| 상품명칭 |
2,4-Dichloro-6-iodoaniline |
| 영문 이름 |
2,4-Dichloro-6-iodoaniline; |
| 분자식 |
C6H4Cl2IN |
| 분자량 |
287.9131 |
| InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| cas번호 |
697-90-5 |
| 분자 구조 |
|
| 밀도 |
2.091g/cm3 |
| 비등점 |
303.8°C at 760 mmHg |
| 굴절 지수 |
1.699 |
| 인화점 |
137.5°C |
| 증기압 |
0.000911mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
