ChemNet > CAS > 700-96-9 3,4-Dimethoxythiophenol
700-96-9 3,4-Dimethoxythiophenol
| 상품명칭 |
3,4-Dimethoxythiophenol |
| 영문 이름 |
3,4-Dimethoxythiophenol; 3,4-Dimethoxybenzenethiol |
| 분자식 |
C8H10O2S |
| 분자량 |
170.22 |
| InChI |
InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
| cas번호 |
700-96-9 |
| 분자 구조 |
|
| 밀도 |
1.19 |
| 비등점 |
110℃(1 torr) |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
