ChemNet > CAS > 701-70-2 Alpha-Ethylphenethyl alcohol
701-70-2 Alpha-Ethylphenethyl alcohol
상품명칭 |
Alpha-Ethylphenethyl alcohol |
영문 이름 |
Alpha-Ethylphenethyl alcohol; 1-Phenyl-2-butanol; 1-phenylbutan-2-ol; (2S)-1-phenylbutan-2-ol; (2R)-1-phenylbutan-2-ol |
분자식 |
C10H14O |
분자량 |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
cas번호 |
701-70-2 |
EC번호 |
211-858-2 |
분자 구조 |
|
밀도 |
0.98g/cm3 |
비등점 |
226.6°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
100°C |
증기압 |
0.0459mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|