ChemNet > CAS > 715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate
715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate
상품명칭 |
Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
영문 이름 |
Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate; 3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
분자식 |
C9H8Br2O4 |
분자량 |
339.9654 |
InChI |
InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
cas번호 |
715-33-3 |
분자 구조 |
|
밀도 |
1.967g/cm3 |
비등점 |
307.4°C at 760 mmHg |
굴절 지수 |
1.636 |
인화점 |
139.7°C |
증기압 |
0.0004mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|